Carboxylic acids and derivatives
Filtered Search Results
Mercaptoacetic acid sodium salt, 98%
CAS: 367-51-1 Molecular Formula: C2H3NaO2S Molecular Weight (g/mol): 114.094 MDL Number: MFCD00043386 InChI Key: GNBVPFITFYNRCN-UHFFFAOYSA-M Synonym: sodium thioglycolate,sodium mercaptoacetate,mercaptoacetic acid sodium salt,mollescal sf,sodium 2-sulfanylacetate,thioglycolate sodium,sodium thioglycollate,mercaptoacetic acid, sodium salt,erhavit d,sodium 2-mercatoethanoate PubChem CID: 23690444 ChEBI: CHEBI:86481 IUPAC Name: sodium;2-sulfanylacetate SMILES: C(C(=O)[O-])S.[Na+]
| PubChem CID | 23690444 |
|---|---|
| CAS | 367-51-1 |
| Molecular Weight (g/mol) | 114.094 |
| ChEBI | CHEBI:86481 |
| MDL Number | MFCD00043386 |
| SMILES | C(C(=O)[O-])S.[Na+] |
| Synonym | sodium thioglycolate,sodium mercaptoacetate,mercaptoacetic acid sodium salt,mollescal sf,sodium 2-sulfanylacetate,thioglycolate sodium,sodium thioglycollate,mercaptoacetic acid, sodium salt,erhavit d,sodium 2-mercatoethanoate |
| IUPAC Name | sodium;2-sulfanylacetate |
| InChI Key | GNBVPFITFYNRCN-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2S |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, ferric sodium salt trihydrate, 98%, pure
CAS: 18154-32-0 Molecular Formula: C10H12FeN2NaO8·3H2O Molecular Weight (g/mol): 421.1 MDL Number: MFCD00798117 InChI Key: MKWYFZFMAMBPQK-UHFFFAOYSA-J Synonym: sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta PubChem CID: 27461 ChEBI: CHEBI:78292 IUPAC Name: sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3]
| PubChem CID | 27461 |
|---|---|
| CAS | 18154-32-0 |
| Molecular Weight (g/mol) | 421.1 |
| ChEBI | CHEBI:78292 |
| MDL Number | MFCD00798117 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3] |
| Synonym | sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta |
| IUPAC Name | sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) |
| InChI Key | MKWYFZFMAMBPQK-UHFFFAOYSA-J |
| Molecular Formula | C10H12FeN2NaO8·3H2O |
Hexyl acetate, 99%
CAS: 142-92-7 Molecular Formula: C8H16O2 Molecular Weight (g/mol): 144.21 InChI Key: AOGQPLXWSUTHQB-UHFFFAOYSA-N Synonym: n-hexyl acetate,1-hexyl acetate,hexyl ethanoate,acetic acid hexyl ester,n-hexyl ethanoate,acetic acid, hexyl ester,hexyl alcohol, acetate,l-hexyl acetate,fema no. 2565,natural PubChem CID: 8908 ChEBI: CHEBI:87510 IUPAC Name: hexyl acetate SMILES: CCCCCCOC(=O)C
| PubChem CID | 8908 |
|---|---|
| CAS | 142-92-7 |
| Molecular Weight (g/mol) | 144.21 |
| ChEBI | CHEBI:87510 |
| SMILES | CCCCCCOC(=O)C |
| Synonym | n-hexyl acetate,1-hexyl acetate,hexyl ethanoate,acetic acid hexyl ester,n-hexyl ethanoate,acetic acid, hexyl ester,hexyl alcohol, acetate,l-hexyl acetate,fema no. 2565,natural |
| IUPAC Name | hexyl acetate |
| InChI Key | AOGQPLXWSUTHQB-UHFFFAOYSA-N |
| Molecular Formula | C8H16O2 |
4-Hydroxybenzamide, 98+%
CAS: 619-57-8 Molecular Formula: C7H7NO2 Molecular Weight (g/mol): 137.14 MDL Number: MFCD00007997 InChI Key: QXSAKPUBHTZHKW-UHFFFAOYSA-N Synonym: benzamide, 4-hydroxy,4-hydroxy-benzamide,p-hydroxybenzamide,unii-9ou5yd093j,4-hydroxy benzamide,1,3,4,9-tetrahydro-2-hydroxybenzoyl-9-4-hydroxyphenyl methyl-6-methoxy-2h-pyrido 3,4-b indole,4-oxidanylbenzamide,acmc-1apvc,para-hydroxybenzoic amide PubChem CID: 65052 IUPAC Name: 4-hydroxybenzamide SMILES: NC(=O)C1=CC=C(O)C=C1
| PubChem CID | 65052 |
|---|---|
| CAS | 619-57-8 |
| Molecular Weight (g/mol) | 137.14 |
| MDL Number | MFCD00007997 |
| SMILES | NC(=O)C1=CC=C(O)C=C1 |
| Synonym | benzamide, 4-hydroxy,4-hydroxy-benzamide,p-hydroxybenzamide,unii-9ou5yd093j,4-hydroxy benzamide,1,3,4,9-tetrahydro-2-hydroxybenzoyl-9-4-hydroxyphenyl methyl-6-methoxy-2h-pyrido 3,4-b indole,4-oxidanylbenzamide,acmc-1apvc,para-hydroxybenzoic amide |
| IUPAC Name | 4-hydroxybenzamide |
| InChI Key | QXSAKPUBHTZHKW-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO2 |
Phthalimidoacetaldehyde 98.0+%, TCI America™
CAS: 2913-97-5 Molecular Formula: C10H7NO3 Molecular Weight (g/mol): 189.17 MDL Number: MFCD00023080 InChI Key: LMRDBJZQDUVCQH-UHFFFAOYSA-N Synonym: N-(Formylmethyl)phthalimide PubChem CID: 76201 IUPAC Name: 2-(1,3-dioxoisoindol-2-yl)acetaldehyde SMILES: C1=CC=C2C(=C1)C(=O)N(C2=O)CC=O
| PubChem CID | 76201 |
|---|---|
| CAS | 2913-97-5 |
| Molecular Weight (g/mol) | 189.17 |
| MDL Number | MFCD00023080 |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC=O |
| Synonym | N-(Formylmethyl)phthalimide |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)acetaldehyde |
| InChI Key | LMRDBJZQDUVCQH-UHFFFAOYSA-N |
| Molecular Formula | C10H7NO3 |
Citric acid, monosodium salt, 99%, for analysis, anhydrous
CAS: 18996-35-5 Molecular Formula: C6H7NaO7 Molecular Weight (g/mol): 214.11 InChI Key: SLWOXBQHKZPUNY-UHFFFAOYSA-N Synonym: bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? PubChem CID: 131675399 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;molecular hydrogen;sodium SMILES: [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na]
| PubChem CID | 131675399 |
|---|---|
| CAS | 18996-35-5 |
| Molecular Weight (g/mol) | 214.11 |
| SMILES | [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na] |
| Synonym | bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;molecular hydrogen;sodium |
| InChI Key | SLWOXBQHKZPUNY-UHFFFAOYSA-N |
| Molecular Formula | C6H7NaO7 |
Ethyl palmitate, 97%
CAS: 628-97-7 Molecular Formula: C18H36O2 Molecular Weight (g/mol): 284.48 MDL Number: MFCD00008996 InChI Key: XIRNKXNNONJFQO-UHFFFAOYSA-N Synonym: ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm PubChem CID: 12366 ChEBI: CHEBI:84932 IUPAC Name: ethyl hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 12366 |
|---|---|
| CAS | 628-97-7 |
| Molecular Weight (g/mol) | 284.48 |
| ChEBI | CHEBI:84932 |
| MDL Number | MFCD00008996 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl palmitate,hexadecanoic acid, ethyl ester,palmitic acid ethyl ester,ethyl cetylate,palmitic acid, ethyl ester,ethylpalmitate,unii-ird3m534zm,hexadecanoic acid ethyl ester,ethyl n-hexadecanoate,ird3m534zm |
| IUPAC Name | ethyl hexadecanoate |
| InChI Key | XIRNKXNNONJFQO-UHFFFAOYSA-N |
| Molecular Formula | C18H36O2 |
Ethyl methacrylate, 99%, stabilized
CAS: 97-63-2 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00009161 InChI Key: SUPCQIBBMFXVTL-UHFFFAOYSA-N Synonym: ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester PubChem CID: 7343 IUPAC Name: ethyl 2-methylprop-2-enoate SMILES: CCOC(=O)C(=C)C
| PubChem CID | 7343 |
|---|---|
| CAS | 97-63-2 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00009161 |
| SMILES | CCOC(=O)C(=C)C |
| Synonym | ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester |
| IUPAC Name | ethyl 2-methylprop-2-enoate |
| InChI Key | SUPCQIBBMFXVTL-UHFFFAOYSA-N |
| Molecular Formula | C6H10O2 |
1-Naphthylacetic acid, 95%
CAS: 86-87-3 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00004046 InChI Key: PRPINYUDVPFIRX-UHFFFAOYSA-N Synonym: 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop PubChem CID: 6862 ChEBI: CHEBI:32918 IUPAC Name: 2-naphthalen-1-ylacetic acid SMILES: OC(=O)CC1=C2C=CC=CC2=CC=C1
| PubChem CID | 6862 |
|---|---|
| CAS | 86-87-3 |
| Molecular Weight (g/mol) | 186.21 |
| ChEBI | CHEBI:32918 |
| MDL Number | MFCD00004046 |
| SMILES | OC(=O)CC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop |
| IUPAC Name | 2-naphthalen-1-ylacetic acid |
| InChI Key | PRPINYUDVPFIRX-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
Isopropyl Cinnamate 98.0+%, TCI America™
CAS: 7780-06-5 Molecular Formula: C12H14O2 Molecular Weight (g/mol): 190.24 MDL Number: MFCD00048292 InChI Key: RGACABDFLVLVCT-CMDGGOBGSA-N Synonym: isopropyl cinnamate,cinnamic acid, isopropyl ester,iso-propyl cinnamate,2-propenoic acid, 3-phenyl-, 1-methylethyl ester,1-methylethyl 3-phenylpropenoate,unii-6rwc10bdd7,isopropyl 3-phenylpropenoate,fema no. 2939,trans-cinnamic acid isopropyl ester,isopropyl 3-phenylacrylate PubChem CID: 5273464 IUPAC Name: propan-2-yl (E)-3-phenylprop-2-enoate SMILES: CC(C)OC(=O)C=CC1=CC=CC=C1
| PubChem CID | 5273464 |
|---|---|
| CAS | 7780-06-5 |
| Molecular Weight (g/mol) | 190.24 |
| MDL Number | MFCD00048292 |
| SMILES | CC(C)OC(=O)C=CC1=CC=CC=C1 |
| Synonym | isopropyl cinnamate,cinnamic acid, isopropyl ester,iso-propyl cinnamate,2-propenoic acid, 3-phenyl-, 1-methylethyl ester,1-methylethyl 3-phenylpropenoate,unii-6rwc10bdd7,isopropyl 3-phenylpropenoate,fema no. 2939,trans-cinnamic acid isopropyl ester,isopropyl 3-phenylacrylate |
| IUPAC Name | propan-2-yl (E)-3-phenylprop-2-enoate |
| InChI Key | RGACABDFLVLVCT-CMDGGOBGSA-N |
| Molecular Formula | C12H14O2 |
Ethyl DL-2-Methylbutyrate 98.0+%, TCI America™
CAS: 7452-79-1 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.187 MDL Number: MFCD00012217 InChI Key: HCRBXQFHJMCTLF-UHFFFAOYSA-N Synonym: ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci PubChem CID: 24020 IUPAC Name: ethyl 2-methylbutanoate SMILES: CCC(C)C(=O)OCC
| PubChem CID | 24020 |
|---|---|
| CAS | 7452-79-1 |
| Molecular Weight (g/mol) | 130.187 |
| MDL Number | MFCD00012217 |
| SMILES | CCC(C)C(=O)OCC |
| Synonym | ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci |
| IUPAC Name | ethyl 2-methylbutanoate |
| InChI Key | HCRBXQFHJMCTLF-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Methyl Propionate 99.0+%, TCI America™
CAS: 554-12-1 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 MDL Number: MFCD00009306 InChI Key: RJUFJBKOKNCXHH-UHFFFAOYSA-N Synonym: methyl propionate,propanoic acid, methyl ester,methyl propylate,methylpropionate,propionic acid, methyl ester,propionate de methyle,propanoic acid methyl ester,fema number 2742,propionic acid methyl ester,methyl propionate natural PubChem CID: 11124 IUPAC Name: methyl propanoate SMILES: CCC(=O)OC
| PubChem CID | 11124 |
|---|---|
| CAS | 554-12-1 |
| Molecular Weight (g/mol) | 88.106 |
| MDL Number | MFCD00009306 |
| SMILES | CCC(=O)OC |
| Synonym | methyl propionate,propanoic acid, methyl ester,methyl propylate,methylpropionate,propionic acid, methyl ester,propionate de methyle,propanoic acid methyl ester,fema number 2742,propionic acid methyl ester,methyl propionate natural |
| IUPAC Name | methyl propanoate |
| InChI Key | RJUFJBKOKNCXHH-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
1,3,5-Benzenetricarboxylic Acid 98.0+%, TCI America™
CAS: 554-95-0 Molecular Formula: C9H6O6 Molecular Weight (g/mol): 210.14 MDL Number: MFCD00002517 InChI Key: QMKYBPDZANOJGF-UHFFFAOYSA-N Synonym: trimesic acid,1,3,5-benzenetricarboxylic acid,trimesinic acid,trimesitinic acid,5-carboxyisophthalic acid,1,3,5-benzene tricarboxylic acid,1,3,5-tricarboxybenzene,unii-ou36oo5mtn,ou36oo5mtn,chembl77562 PubChem CID: 11138 ChEBI: CHEBI:46032 IUPAC Name: benzene-1,3,5-tricarboxylic acid SMILES: OC(=O)C1=CC(=CC(=C1)C(O)=O)C(O)=O
| PubChem CID | 11138 |
|---|---|
| CAS | 554-95-0 |
| Molecular Weight (g/mol) | 210.14 |
| ChEBI | CHEBI:46032 |
| MDL Number | MFCD00002517 |
| SMILES | OC(=O)C1=CC(=CC(=C1)C(O)=O)C(O)=O |
| Synonym | trimesic acid,1,3,5-benzenetricarboxylic acid,trimesinic acid,trimesitinic acid,5-carboxyisophthalic acid,1,3,5-benzene tricarboxylic acid,1,3,5-tricarboxybenzene,unii-ou36oo5mtn,ou36oo5mtn,chembl77562 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid |
| InChI Key | QMKYBPDZANOJGF-UHFFFAOYSA-N |
| Molecular Formula | C9H6O6 |
2,2,2-Trifluoroethyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
CAS: 352-87-4 Molecular Formula: C6H7F3O2 Molecular Weight (g/mol): 168.12 MDL Number: MFCD00013576,MFCD00274739 InChI Key: QTKPMCIBUROOGY-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z PubChem CID: 9608 IUPAC Name: 2,2,2-trifluoroethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)F
| PubChem CID | 9608 |
|---|---|
| CAS | 352-87-4 |
| Molecular Weight (g/mol) | 168.12 |
| MDL Number | MFCD00013576,MFCD00274739 |
| SMILES | CC(=C)C(=O)OCC(F)(F)F |
| Synonym | 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z |
| IUPAC Name | 2,2,2-trifluoroethyl 2-methylprop-2-enoate |
| InChI Key | QTKPMCIBUROOGY-UHFFFAOYSA-N |
| Molecular Formula | C6H7F3O2 |
Nicotinic Acid Hydrazide 98.0+%, TCI America™
CAS: 553-53-7 Molecular Formula: C6H7N3O Molecular Weight (g/mol): 137.14 MDL Number: MFCD00006383 InChI Key: KFUSANSHCADHNJ-UHFFFAOYSA-N Synonym: nicotinohydrazide,nicotinic acid hydrazide,nicotinic hydrazide,niazid,nicotinylhydrazide,nicotinoyl hydrazine,3-pyridoyl hydrazine,3-pyridylcarbonylhydrazine,nicotinoyl hydrazide,hydrazine, nicotinoyl PubChem CID: 11112 IUPAC Name: pyridine-3-carbohydrazide SMILES: NNC(=O)C1=CC=CN=C1
| PubChem CID | 11112 |
|---|---|
| CAS | 553-53-7 |
| Molecular Weight (g/mol) | 137.14 |
| MDL Number | MFCD00006383 |
| SMILES | NNC(=O)C1=CC=CN=C1 |
| Synonym | nicotinohydrazide,nicotinic acid hydrazide,nicotinic hydrazide,niazid,nicotinylhydrazide,nicotinoyl hydrazine,3-pyridoyl hydrazine,3-pyridylcarbonylhydrazine,nicotinoyl hydrazide,hydrazine, nicotinoyl |
| IUPAC Name | pyridine-3-carbohydrazide |
| InChI Key | KFUSANSHCADHNJ-UHFFFAOYSA-N |
| Molecular Formula | C6H7N3O |